C9H13ClN3+ — CID 159045651
1,2-dimethylindazol-2-ium-6-amine;hydrochloride (PubChem CID 159045651) has the molecular formula C9H13ClN3+ and a molecular weight of 198.68 g/mol. Its IUPAC name is 1,2-dimethylindazol-2-ium-6-amine;hydrochloride.
| Compound Name | 1,2-dimethylindazol-2-ium-6-amine;hydrochloride |
|---|---|
| PubChem CID | 159045651 |
| Molecular Formula | C9H13ClN3+ |
| Molecular Weight | 198.68 g/mol |
| Exact Mass | 198.08 |
| IUPAC Name | 1,2-dimethylindazol-2-ium-6-amine;hydrochloride |
| SMILES | Cl.Cn1c2cc(N)ccc2c[n+]1C |
| InChI | InChI=1S/C9H11N3.ClH/c1-11-6-7-3-4-8(10)5-9(7)12(11)2;/h3-6,10H,1-2H3;1H/p+1 |
| InChIKey | JWPTTWJREQENAZ-UHFFFAOYSA-O |
| XLogP | 1.01 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.68 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|