C15H18Cl2N3+ — CID 158791095
chloromethane;10-methylacridin-10-ium-3,6-diamine;hydrochloride (PubChem CID 158791095) has the molecular formula C15H18Cl2N3+ and a molecular weight of 311.24 g/mol. Its IUPAC name is chloromethane;10-methylacridin-10-ium-3,6-diamine;hydrochloride.
| Compound Name | chloromethane;10-methylacridin-10-ium-3,6-diamine;hydrochloride |
|---|---|
| PubChem CID | 158791095 |
| Molecular Formula | C15H18Cl2N3+ |
| Molecular Weight | 311.24 g/mol |
| Exact Mass | 310.09 |
| IUPAC Name | chloromethane;10-methylacridin-10-ium-3,6-diamine;hydrochloride |
| SMILES | CCl.C[n+]1c2cc(N)ccc2cc2ccc(N)cc21.Cl |
| InChI | InChI=1S/C14H13N3.CH3Cl.ClH/c1-17-13-7-11(15)4-2-9(13)6-10-3-5-12(16)8-14(10)17;1-2;/h2-8H,1H3,(H3,15,16);1H3;1H/p+1 |
| InChIKey | FUYLEKPBHRDHID-UHFFFAOYSA-O |
| XLogP | 3.26 |
| TPSA | 55.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.24 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|