C24H30BF4N3O2 — CID 164529385
N-[6-(2,2-dimethylpropanoylamino)-10-methylacridin-10-ium-3-yl]-2,2-dimethylpropanamide tetrafluoroborate (PubChem CID 164529385) has the molecular formula C24H30BF4N3O2 and a molecular weight of 479.33 g/mol. Its IUPAC name is N-[6-(2,2-dimethylpropanoylamino)-10-methylacridin-10-ium-3-yl]-2,2-dimethylpropanamide tetrafluoroborate.
| Compound Name | N-[6-(2,2-dimethylpropanoylamino)-10-methylacridin-10-ium-3-yl]-2,2-dimethylpropanamide tetrafluoroborate |
|---|---|
| PubChem CID | 164529385 |
| Molecular Formula | C24H30BF4N3O2 |
| Molecular Weight | 479.33 g/mol |
| Exact Mass | 479.24 |
| IUPAC Name | N-[6-(2,2-dimethylpropanoylamino)-10-methylacridin-10-ium-3-yl]-2,2-dimethylpropanamide tetrafluoroborate |
| SMILES | C[n+]1c2cc(NC(=O)C(C)(C)C)ccc2cc2ccc(NC(=O)C(C)(C)C)cc21.F[B-](F)(F)F |
| InChI | InChI=1S/C24H29N3O2.BF4/c1-23(2,3)21(28)25-17-10-8-15-12-16-9-11-18(26-22(29)24(4,5)6)14-20(16)27(7)19(15)13-17;2-1(3,4)5/h8-14H,1-7H3,(H,25,26,28,29);/q;-1/p+1 |
| InChIKey | VQZACSOYSSUXDU-UHFFFAOYSA-O |
| XLogP | 6.09 |
| TPSA | 62.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.33 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|