C20H25N3O — CID 164529364
N-(6-aminoacridin-3-yl)-2,2-dimethylpropanamide;ethane (PubChem CID 164529364) has the molecular formula C20H25N3O and a molecular weight of 323.44 g/mol. Its IUPAC name is N-(6-aminoacridin-3-yl)-2,2-dimethylpropanamide;ethane.
| Compound Name | N-(6-aminoacridin-3-yl)-2,2-dimethylpropanamide;ethane |
|---|---|
| PubChem CID | 164529364 |
| Molecular Formula | C20H25N3O |
| Molecular Weight | 323.44 g/mol |
| Exact Mass | 323.20 |
| IUPAC Name | N-(6-aminoacridin-3-yl)-2,2-dimethylpropanamide;ethane |
| SMILES | CC.CC(C)(C)C(=O)Nc1ccc2cc3ccc(N)cc3nc2c1 |
| InChI | InChI=1S/C18H19N3O.C2H6/c1-18(2,3)17(22)20-14-7-5-12-8-11-4-6-13(19)9-15(11)21-16(12)10-14;1-2/h4-10H,19H2,1-3H3,(H,20,22);1-2H3 |
| InChIKey | GNZIFDQZCNRLPO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.44 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|