C23H24N2O2S2 — CID 159061603
tert-butyl 2-[[7-(4-isocyanophenyl)-2-methyl-1,3-benzothiazol-6-yl]sulfanyl]-2-methylpropanoate (PubChem CID 159061603) has the molecular formula C23H24N2O2S2 and a molecular weight of 424.59 g/mol. Its IUPAC name is tert-butyl 2-[[7-(4-isocyanophenyl)-2-methyl-1,3-benzothiazol-6-yl]sulfanyl]-2-methylpropanoate.
| Compound Name | tert-butyl 2-[[7-(4-isocyanophenyl)-2-methyl-1,3-benzothiazol-6-yl]sulfanyl]-2-methylpropanoate |
|---|---|
| PubChem CID | 159061603 |
| Molecular Formula | C23H24N2O2S2 |
| Molecular Weight | 424.59 g/mol |
| Exact Mass | 424.13 |
| IUPAC Name | tert-butyl 2-[[7-(4-isocyanophenyl)-2-methyl-1,3-benzothiazol-6-yl]sulfanyl]-2-methylpropanoate |
| SMILES | [C-]#[N+]c1ccc(-c2c(SC(C)(C)C(=O)OC(C)(C)C)ccc3nc(C)sc23)cc1 |
| InChI | InChI=1S/C23H24N2O2S2/c1-14-25-17-12-13-18(29-23(5,6)21(26)27-22(2,3)4)19(20(17)28-14)15-8-10-16(24-7)11-9-15/h8-13H,1-6H3 |
| InChIKey | JYNQLULQMCZFQC-UHFFFAOYSA-N |
| XLogP | 7.03 |
| TPSA | 43.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.59 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|