4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen

C10H23NO — CID 159062598

IUPAC4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen
SMILESCC(C)(C)NC1CCC(O)CC1.[H][H]
InChIInChI=1S/C10H21NO.H2/c1-10(2,3)11-8-4-6-9(12)7-5-8;/h8-9,11-12H,4-7H2,1-3H3;1H
InChIKeyJYQSAQLOSLNTOI-UHFFFAOYSA-N
MW173.30 g/mol
LogP1.92
Rot. Bonds1

About 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen

4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen (PubChem CID 159062598) has the molecular formula C10H23NO and a molecular weight of 173.30 g/mol. Its IUPAC name is 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen.

Molecular Properties

Compound Name4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen
PubChem CID159062598
Molecular FormulaC10H23NO
Molecular Weight173.30 g/mol
Exact Mass173.18
IUPAC Name4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen
SMILESCC(C)(C)NC1CCC(O)CC1.[H][H]
InChIInChI=1S/C10H21NO.H2/c1-10(2,3)11-8-4-6-9(12)7-5-8;/h8-9,11-12H,4-7H2,1-3H3;1H
InChIKeyJYQSAQLOSLNTOI-UHFFFAOYSA-N
XLogP1.92
TPSA32.26 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds1
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500173.30
LogP ≤ 51.92
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen?
The IUPAC name of 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen (CID 159062598) is 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen.
What is the SMILES notation for 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen?
The canonical SMILES for 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen is CC(C)(C)NC1CCC(O)CC1.[H][H].
What is the InChIKey of 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen?
The InChIKey is JYQSAQLOSLNTOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H21NO.H2/c1-10(2,3)11-8-4-6-9(12)7-5-8;/h8-9,11-12H,4-7H2,1-3H3;1H.
What are the key properties of 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen?
4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen has a molecular weight of 173.30 g/mol, XLogP of 1.92, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(tert-butylamino)cyclohexan-1-ol;molecular hydrogen is sourced from PubChem (CID 159062598), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).