C33H38BBrFN2O2+ — CID 159066166
2-bromo-3H-pyridin-3-ylium;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(3,4,5-trimethylphenyl)pyridine (PubChem CID 159066166) has the molecular formula C33H38BBrFN2O2+ and a molecular weight of 604.39 g/mol. Its IUPAC name is 2-bromo-3H-pyridin-3-ylium;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(3,4,5-trimethylphenyl)pyridine.
| Compound Name | 2-bromo-3H-pyridin-3-ylium;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(3,4,5-trimethylphenyl)pyridine |
|---|---|
| PubChem CID | 159066166 |
| Molecular Formula | C33H38BBrFN2O2+ |
| Molecular Weight | 604.39 g/mol |
| Exact Mass | 603.22 |
| IUPAC Name | 2-bromo-3H-pyridin-3-ylium;2-(4-fluoro-3,5-dimethylphenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane;2-(3,4,5-trimethylphenyl)pyridine |
| SMILES | BrC1=[C+]C=CC=N1.Cc1cc(-c2ccccn2)cc(C)c1C.Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(C)c1F |
| InChI | InChI=1S/C14H20BFO2.C14H15N.C5H3BrN/c1-9-7-11(8-10(2)12(9)16)15-17-13(3,4)14(5,6)18-15;1-10-8-13(9-11(2)12(10)3)14-6-4-5-7-15-14;6-5-3-1-2-4-7-5/h7-8H,1-6H3;4-9H,1-3H3;1-2,4H/q;;+1 |
| InChIKey | JZBSDVVDIPIQPG-UHFFFAOYSA-N |
| XLogP | 8.08 |
| TPSA | 43.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.39 |
| LogP ≤ 5 | 8.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|