C26H27Cl2N5 — CID 159097739
1,2-bis(chloromethyl)benzene;1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole;3H-pyrrole (PubChem CID 159097739) has the molecular formula C26H27Cl2N5 and a molecular weight of 480.44 g/mol. Its IUPAC name is 1,2-bis(chloromethyl)benzene;1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole;3H-pyrrole.
| Compound Name | 1,2-bis(chloromethyl)benzene;1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole;3H-pyrrole |
|---|---|
| PubChem CID | 159097739 |
| Molecular Formula | C26H27Cl2N5 |
| Molecular Weight | 480.44 g/mol |
| Exact Mass | 479.16 |
| IUPAC Name | 1,2-bis(chloromethyl)benzene;1-[[2-(imidazol-1-ylmethyl)phenyl]methyl]imidazole;3H-pyrrole |
| SMILES | C1=CN=CC1.ClCc1ccccc1CCl.c1ccc(Cn2ccnc2)c(Cn2ccnc2)c1 |
| InChI | InChI=1S/C14H14N4.C8H8Cl2.C4H5N/c1-2-4-14(10-18-8-6-16-12-18)13(3-1)9-17-7-5-15-11-17;9-5-7-3-1-2-4-8(7)6-10;1-2-4-5-3-1/h1-8,11-12H,9-10H2;1-4H,5-6H2;1,3-4H,2H2 |
| InChIKey | KCWONSOFZJMLAM-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.44 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|