C20H24Cl2N2O4 — CID 159101733
(3S)-3-[3-[4-(3,5-dichloro-2-methoxyphenyl)piperidin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione (PubChem CID 159101733) has the molecular formula C20H24Cl2N2O4 and a molecular weight of 427.33 g/mol. Its IUPAC name is (3S)-3-[3-[4-(3,5-dichloro-2-methoxyphenyl)piperidin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione.
| Compound Name | (3S)-3-[3-[4-(3,5-dichloro-2-methoxyphenyl)piperidin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159101733 |
| Molecular Formula | C20H24Cl2N2O4 |
| Molecular Weight | 427.33 g/mol |
| Exact Mass | 426.11 |
| IUPAC Name | (3S)-3-[3-[4-(3,5-dichloro-2-methoxyphenyl)piperidin-1-yl]-3-oxopropyl]-3-methylpyrrolidine-2,5-dione |
| SMILES | COc1c(Cl)cc(Cl)cc1C1CCN(C(=O)CC[C@@]2(C)CC(=O)NC2=O)CC1 |
| InChI | InChI=1S/C20H24Cl2N2O4/c1-20(11-16(25)23-19(20)27)6-3-17(26)24-7-4-12(5-8-24)14-9-13(21)10-15(22)18(14)28-2/h9-10,12H,3-8,11H2,1-2H3,(H,23,25,27)/t20-/m0/s1 |
| InChIKey | KDJHOSJRVANDJS-FQEVSTJZSA-N |
| XLogP | 3.54 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.33 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|