C18H30N3O5+ — CID 159108771
[(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]azanium;(2S)-2-formamido-4-methylpentanoic acid (PubChem CID 159108771) has the molecular formula C18H30N3O5+ and a molecular weight of 368.45 g/mol. Its IUPAC name is [(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]azanium;(2S)-2-formamido-4-methylpentanoic acid.
| Compound Name | [(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]azanium;(2S)-2-formamido-4-methylpentanoic acid |
|---|---|
| PubChem CID | 159108771 |
| Molecular Formula | C18H30N3O5+ |
| Molecular Weight | 368.45 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | [(2R)-1-(benzylamino)-3-methoxy-1-oxopropan-2-yl]azanium;(2S)-2-formamido-4-methylpentanoic acid |
| SMILES | CC(C)C[C@H](NC=O)C(=O)O.COC[C@@H]([NH3+])C(=O)NCc1ccccc1 |
| InChI | InChI=1S/C11H16N2O2.C7H13NO3/c1-15-8-10(12)11(14)13-7-9-5-3-2-4-6-9;1-5(2)3-6(7(10)11)8-4-9/h2-6,10H,7-8,12H2,1H3,(H,13,14);4-6H,3H2,1-2H3,(H,8,9)(H,10,11)/p+1/t10-;6-/m10/s1 |
| InChIKey | KEFHCMVIYHEOLB-RLEZYWNBSA-O |
| XLogP | -0.21 |
| TPSA | 132.37 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.45 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|