About 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene
1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene (PubChem CID 159109555) has the molecular formula C16H18I2
and a molecular weight of 464.13 g/mol. Its IUPAC name is 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene.
Molecular Properties
| Compound Name | 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene |
| PubChem CID | 159109555 |
| Molecular Formula | C16H18I2 |
| Molecular Weight | 464.13 g/mol |
| Exact Mass | 463.95 |
| IUPAC Name | 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene |
| SMILES | CCc1ccc(I)cc1.CCc1ccccc1I |
| InChI | InChI=1S/2C8H9I/c1-2-7-3-5-8(9)6-4-7;1-2-7-5-3-4-6-8(7)9/h2*3-6H,2H2,1H3 |
| InChIKey | KEHUNWBXLLXYPJ-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 464.13 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene?
The IUPAC name of 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene (CID 159109555) is 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene.
What is the SMILES notation for 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene?
The canonical SMILES for 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene is CCc1ccc(I)cc1.CCc1ccccc1I.
What is the InChIKey of 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene?
The InChIKey is KEHUNWBXLLXYPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H9I/c1-2-7-3-5-8(9)6-4-7;1-2-7-5-3-4-6-8(7)9/h2*3-6H,2H2,1H3.
What are the key properties of 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene?
1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene has a molecular weight of 464.13 g/mol, XLogP of 5.71, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-iodobenzene;1-ethyl-4-iodobenzene is sourced from PubChem (CID 159109555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).