C10H20O7 — CID 159117915
acetic acid;1-hydroxypropan-2-yl methyl carbonate;2-methyloxirane (PubChem CID 159117915) has the molecular formula C10H20O7 and a molecular weight of 252.26 g/mol. Its IUPAC name is acetic acid;1-hydroxypropan-2-yl methyl carbonate;2-methyloxirane.
| Compound Name | acetic acid;1-hydroxypropan-2-yl methyl carbonate;2-methyloxirane |
|---|---|
| PubChem CID | 159117915 |
| Molecular Formula | C10H20O7 |
| Molecular Weight | 252.26 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | acetic acid;1-hydroxypropan-2-yl methyl carbonate;2-methyloxirane |
| SMILES | CC(=O)O.CC1CO1.COC(=O)OC(C)CO |
| InChI | InChI=1S/C5H10O4.C3H6O.C2H4O2/c1-4(3-6)9-5(7)8-2;1-3-2-4-3;1-2(3)4/h4,6H,3H2,1-2H3;3H,2H2,1H3;1H3,(H,3,4) |
| InChIKey | NKGMGFUMBNFYEQ-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 105.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.26 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|