About 1,2-dichloropropane;2-methyloxirane;propanoic acid
1,2-dichloropropane;2-methyloxirane;propanoic acid (PubChem CID 88783469) has the molecular formula C9H18Cl2O3
and a molecular weight of 245.15 g/mol. Its IUPAC name is 1,2-dichloropropane;2-methyloxirane;propanoic acid.
Molecular Properties
| Compound Name | 1,2-dichloropropane;2-methyloxirane;propanoic acid |
| PubChem CID | 88783469 |
| Molecular Formula | C9H18Cl2O3 |
| Molecular Weight | 245.15 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1,2-dichloropropane;2-methyloxirane;propanoic acid |
| SMILES | CC(Cl)CCl.CC1CO1.CCC(=O)O |
| InChI | InChI=1S/C3H6Cl2.C3H6O2.C3H6O/c1-3(5)2-4;1-2-3(4)5;1-3-2-4-3/h3H,2H2,1H3;2H2,1H3,(H,4,5);3H,2H2,1H3 |
| InChIKey | YYKASPAUCKIUTR-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 49.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 245.15 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dichloropropane;2-methyloxirane;propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dichloropropane;2-methyloxirane;propanoic acid?
The IUPAC name of 1,2-dichloropropane;2-methyloxirane;propanoic acid (CID 88783469) is 1,2-dichloropropane;2-methyloxirane;propanoic acid.
What is the SMILES notation for 1,2-dichloropropane;2-methyloxirane;propanoic acid?
The canonical SMILES for 1,2-dichloropropane;2-methyloxirane;propanoic acid is CC(Cl)CCl.CC1CO1.CCC(=O)O.
What is the InChIKey of 1,2-dichloropropane;2-methyloxirane;propanoic acid?
The InChIKey is YYKASPAUCKIUTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6Cl2.C3H6O2.C3H6O/c1-3(5)2-4;1-2-3(4)5;1-3-2-4-3/h3H,2H2,1H3;2H2,1H3,(H,4,5);3H,2H2,1H3.
What are the key properties of 1,2-dichloropropane;2-methyloxirane;propanoic acid?
1,2-dichloropropane;2-methyloxirane;propanoic acid has a molecular weight of 245.15 g/mol, XLogP of 2.74, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dichloropropane;2-methyloxirane;propanoic acid is sourced from PubChem (CID 88783469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).