C14H17BrN4O4 — CID 159118595
ethyl 2-diazoacetate;trans-ethyl (1R,2R)-2-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate (PubChem CID 159118595) has the molecular formula C14H17BrN4O4 and a molecular weight of 385.22 g/mol. Its IUPAC name is ethyl 2-diazoacetate;trans-ethyl (1R,2R)-2-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate.
| Compound Name | ethyl 2-diazoacetate;trans-ethyl (1R,2R)-2-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 159118595 |
| Molecular Formula | C14H17BrN4O4 |
| Molecular Weight | 385.22 g/mol |
| Exact Mass | 384.04 |
| IUPAC Name | ethyl 2-diazoacetate;trans-ethyl (1R,2R)-2-(5-bromopyrazin-2-yl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)C=[N+]=[N-].CCOC(=O)[C@@H]1C[C@H]1c1cnc(Br)cn1 |
| InChI | InChI=1S/C10H11BrN2O2.C4H6N2O2/c1-2-15-10(14)7-3-6(7)8-4-13-9(11)5-12-8;1-2-8-4(7)3-6-5/h4-7H,2-3H2,1H3;3H,2H2,1H3/t6-,7-;/m1./s1 |
| InChIKey | KFKAISHROFSOPW-ZJLYAJKPSA-N |
| XLogP | 1.76 |
| TPSA | 114.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.22 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|