C20H26N4O10 — CID 159122898
methyl 5-amino-2-(2-methoxyethoxy)pyridine-4-carboxylate;methyl 2-(2-methoxyethoxy)-5-nitropyridine-4-carboxylate (PubChem CID 159122898) has the molecular formula C20H26N4O10 and a molecular weight of 482.45 g/mol. Its IUPAC name is methyl 5-amino-2-(2-methoxyethoxy)pyridine-4-carboxylate;methyl 2-(2-methoxyethoxy)-5-nitropyridine-4-carboxylate.
| Compound Name | methyl 5-amino-2-(2-methoxyethoxy)pyridine-4-carboxylate;methyl 2-(2-methoxyethoxy)-5-nitropyridine-4-carboxylate |
|---|---|
| PubChem CID | 159122898 |
| Molecular Formula | C20H26N4O10 |
| Molecular Weight | 482.45 g/mol |
| Exact Mass | 482.16 |
| IUPAC Name | methyl 5-amino-2-(2-methoxyethoxy)pyridine-4-carboxylate;methyl 2-(2-methoxyethoxy)-5-nitropyridine-4-carboxylate |
| SMILES | COCCOc1cc(C(=O)OC)c(N)cn1.COCCOc1cc(C(=O)OC)c([N+](=O)[O-])cn1 |
| InChI | InChI=1S/C10H12N2O6.C10H14N2O4/c1-16-3-4-18-9-5-7(10(13)17-2)8(6-11-9)12(14)15;1-14-3-4-16-9-5-7(10(13)15-2)8(11)6-12-9/h5-6H,3-4H2,1-2H3;5-6H,3-4,11H2,1-2H3 |
| InChIKey | KFXOOLZKPOQDDV-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 184.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.45 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|