C23H27N3O2 — CID 159145290
N-(2-aminophenyl)-8-(1-methylindol-2-yl)-8-oxooctanamide (PubChem CID 159145290) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is N-(2-aminophenyl)-8-(1-methylindol-2-yl)-8-oxooctanamide.
| Compound Name | N-(2-aminophenyl)-8-(1-methylindol-2-yl)-8-oxooctanamide |
|---|---|
| PubChem CID | 159145290 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | N-(2-aminophenyl)-8-(1-methylindol-2-yl)-8-oxooctanamide |
| SMILES | Cn1c(C(=O)CCCCCCC(=O)Nc2ccccc2N)cc2ccccc21 |
| InChI | InChI=1S/C23H27N3O2/c1-26-20-13-9-6-10-17(20)16-21(26)22(27)14-4-2-3-5-15-23(28)25-19-12-8-7-11-18(19)24/h6-13,16H,2-5,14-15,24H2,1H3,(H,25,28) |
| InChIKey | KIPKVWLMVLUHET-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|