C13H22N2OSi — CID 15914609
2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide (PubChem CID 15914609) has the molecular formula C13H22N2OSi and a molecular weight of 250.42 g/mol. Its IUPAC name is 2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide.
| Compound Name | 2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide |
|---|---|
| PubChem CID | 15914609 |
| Molecular Formula | C13H22N2OSi |
| Molecular Weight | 250.42 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | 2,2-dimethyl-N-(3-trimethylsilyl-2-pyridinyl)propanamide |
| SMILES | CC(C)(C)C(=O)Nc1ncccc1[Si](C)(C)C |
| InChI | InChI=1S/C13H22N2OSi/c1-13(2,3)12(16)15-11-10(17(4,5)6)8-7-9-14-11/h7-9H,1-6H3,(H,14,15,16) |
| InChIKey | WJGJZDHOKCDEGB-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|