C10H14BN2O3 — CID 89491536
CID 89491536 (PubChem CID 89491536) has the molecular formula C10H14BN2O3 and a molecular weight of 221.05 g/mol.
| Compound Name | CID 89491536 |
|---|---|
| PubChem CID | 89491536 |
| Molecular Formula | C10H14BN2O3 |
| Molecular Weight | 221.05 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | — |
| SMILES | CC(C)(C)C(=O)Nc1ncccc1O[B]O |
| InChI | InChI=1S/C10H14BN2O3/c1-10(2,3)9(14)13-8-7(16-11-15)5-4-6-12-8/h4-6,15H,1-3H3,(H,12,13,14) |
| InChIKey | QTEJQMBNNUMMNT-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.05 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|