C13H21ClN2OSi — CID 88957514
N-(6-chloro-3-trimethylsilyl-2-pyridinyl)-2,2-dimethylpropanamide (PubChem CID 88957514) has the molecular formula C13H21ClN2OSi and a molecular weight of 284.86 g/mol. Its IUPAC name is N-(6-chloro-3-trimethylsilyl-2-pyridinyl)-2,2-dimethylpropanamide.
| Compound Name | N-(6-chloro-3-trimethylsilyl-2-pyridinyl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 88957514 |
| Molecular Formula | C13H21ClN2OSi |
| Molecular Weight | 284.86 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | N-(6-chloro-3-trimethylsilyl-2-pyridinyl)-2,2-dimethylpropanamide |
| SMILES | CC(C)(C)C(=O)Nc1nc(Cl)ccc1[Si](C)(C)C |
| InChI | InChI=1S/C13H21ClN2OSi/c1-13(2,3)12(17)16-11-9(18(4,5)6)7-8-10(14)15-11/h7-8H,1-6H3,(H,15,16,17) |
| InChIKey | QRBVNJZIJZKUDT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.86 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|