C12H6F7N3 — CID 159147734
3-fluoro-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]-2-(trifluoromethyl)pyrazine (PubChem CID 159147734) has the molecular formula C12H6F7N3 and a molecular weight of 325.19 g/mol. Its IUPAC name is 3-fluoro-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]-2-(trifluoromethyl)pyrazine.
| Compound Name | 3-fluoro-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]-2-(trifluoromethyl)pyrazine |
|---|---|
| PubChem CID | 159147734 |
| Molecular Formula | C12H6F7N3 |
| Molecular Weight | 325.19 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-fluoro-5-[2-methyl-6-(trifluoromethyl)-4-pyridinyl]-2-(trifluoromethyl)pyrazine |
| SMILES | Cc1cc(-c2cnc(C(F)(F)F)c(F)n2)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C12H6F7N3/c1-5-2-6(3-8(21-5)11(14,15)16)7-4-20-9(10(13)22-7)12(17,18)19/h2-4H,1H3 |
| InChIKey | HSZUJRRRHFKFNW-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.19 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |