C18H30O9 — CID 159155027
butanoic acid;hydroxymethyl 2-methylprop-2-enoate;2-methylprop-2-enoyloxymethyl butanoate (PubChem CID 159155027) has the molecular formula C18H30O9 and a molecular weight of 390.43 g/mol. Its IUPAC name is butanoic acid;hydroxymethyl 2-methylprop-2-enoate;2-methylprop-2-enoyloxymethyl butanoate.
| Compound Name | butanoic acid;hydroxymethyl 2-methylprop-2-enoate;2-methylprop-2-enoyloxymethyl butanoate |
|---|---|
| PubChem CID | 159155027 |
| Molecular Formula | C18H30O9 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.19 |
| IUPAC Name | butanoic acid;hydroxymethyl 2-methylprop-2-enoate;2-methylprop-2-enoyloxymethyl butanoate |
| SMILES | C=C(C)C(=O)OCO.C=C(C)C(=O)OCOC(=O)CCC.CCCC(=O)O |
| InChI | InChI=1S/C9H14O4.C5H8O3.C4H8O2/c1-4-5-8(10)12-6-13-9(11)7(2)3;1-4(2)5(7)8-3-6;1-2-3-4(5)6/h2,4-6H2,1,3H3;6H,1,3H2,2H3;2-3H2,1H3,(H,5,6) |
| InChIKey | KJTXCRKMLBCEQC-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 136.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|