C29H36N2O — CID 159155460
1-tert-butyl-4-ethynylbenzene;(E)-3-(4-tert-butylphenyl)prop-2-enenitrile;2-hydroxy-2-methylpropanenitrile (PubChem CID 159155460) has the molecular formula C29H36N2O and a molecular weight of 428.62 g/mol. Its IUPAC name is 1-tert-butyl-4-ethynylbenzene;(E)-3-(4-tert-butylphenyl)prop-2-enenitrile;2-hydroxy-2-methylpropanenitrile.
| Compound Name | 1-tert-butyl-4-ethynylbenzene;(E)-3-(4-tert-butylphenyl)prop-2-enenitrile;2-hydroxy-2-methylpropanenitrile |
|---|---|
| PubChem CID | 159155460 |
| Molecular Formula | C29H36N2O |
| Molecular Weight | 428.62 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 1-tert-butyl-4-ethynylbenzene;(E)-3-(4-tert-butylphenyl)prop-2-enenitrile;2-hydroxy-2-methylpropanenitrile |
| SMILES | C#Cc1ccc(C(C)(C)C)cc1.CC(C)(C)c1ccc(/C=C/C#N)cc1.CC(C)(O)C#N |
| InChI | InChI=1S/C13H15N.C12H14.C4H7NO/c1-13(2,3)12-8-6-11(7-9-12)5-4-10-14;1-5-10-6-8-11(9-7-10)12(2,3)4;1-4(2,6)3-5/h4-9H,1-3H3;1,6-9H,2-4H3;6H,1-2H3/b5-4+;; |
| InChIKey | KJVHHWPALGDJEI-SFKRKKMESA-N |
| XLogP | 6.77 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.62 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'cyanohydrins', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|