C16H25O3P — CID 159169175
(5R)-5-benzyl-6-(hydroxy-methyl-methylidene-λ5-phosphanyl)oxy-2-methylhexan-3-one (PubChem CID 159169175) has the molecular formula C16H25O3P and a molecular weight of 296.35 g/mol. Its IUPAC name is (5R)-5-benzyl-6-(hydroxy-methyl-methylidene-λ5-phosphanyl)oxy-2-methylhexan-3-one.
| Compound Name | (5R)-5-benzyl-6-(hydroxy-methyl-methylidene-λ5-phosphanyl)oxy-2-methylhexan-3-one |
|---|---|
| PubChem CID | 159169175 |
| Molecular Formula | C16H25O3P |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | (5R)-5-benzyl-6-(hydroxy-methyl-methylidene-λ5-phosphanyl)oxy-2-methylhexan-3-one |
| SMILES | C=P(C)(O)OC[C@@H](CC(=O)C(C)C)Cc1ccccc1 |
| InChI | InChI=1S/C16H25O3P/c1-13(2)16(17)11-15(12-19-20(3,4)18)10-14-8-6-5-7-9-14/h5-9,13,15,18H,3,10-12H2,1-2,4H3/t15-,20?/m1/s1 |
| InChIKey | LKLIRXTZGZZEHT-IWPPFLRJSA-N |
| XLogP | 3.38 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|