C14H17ClN4O — CID 159170536
4-[(5-chloro-1-oxidopyridin-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane (PubChem CID 159170536) has the molecular formula C14H17ClN4O and a molecular weight of 292.77 g/mol. Its IUPAC name is 4-[(5-chloro-1-oxidopyridin-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane.
| Compound Name | 4-[(5-chloro-1-oxidopyridin-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane |
|---|---|
| PubChem CID | 159170536 |
| Molecular Formula | C14H17ClN4O |
| Molecular Weight | 292.77 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[(5-chloro-1-oxidopyridin-1-ium-2-yl)diazenyl]-N,N-dimethylaniline;methane |
| SMILES | C.CN(C)c1ccc(/N=N/c2ccc(Cl)c[n+]2[O-])cc1 |
| InChI | InChI=1S/C13H13ClN4O.CH4/c1-17(2)12-6-4-11(5-7-12)15-16-13-8-3-10(14)9-18(13)19;/h3-9H,1-2H3;1H4/b16-15+; |
| InChIKey | KLQAOSSXGCFSKM-GEEYTBSJSA-N |
| XLogP | 4.09 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.77 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|