C18H24BF3N2O4 — CID 159178104
[(1S)-3-methyl-1-[[4-oxo-4-[(2S)-1-(2,4,5-trifluorophenyl)azetidin-2-yl]butanoyl]amino]butyl]boronic acid (PubChem CID 159178104) has the molecular formula C18H24BF3N2O4 and a molecular weight of 400.21 g/mol. Its IUPAC name is [(1S)-3-methyl-1-[[4-oxo-4-[(2S)-1-(2,4,5-trifluorophenyl)azetidin-2-yl]butanoyl]amino]butyl]boronic acid.
| Compound Name | [(1S)-3-methyl-1-[[4-oxo-4-[(2S)-1-(2,4,5-trifluorophenyl)azetidin-2-yl]butanoyl]amino]butyl]boronic acid |
|---|---|
| PubChem CID | 159178104 |
| Molecular Formula | C18H24BF3N2O4 |
| Molecular Weight | 400.21 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | [(1S)-3-methyl-1-[[4-oxo-4-[(2S)-1-(2,4,5-trifluorophenyl)azetidin-2-yl]butanoyl]amino]butyl]boronic acid |
| SMILES | CC(C)C[C@@H](NC(=O)CCC(=O)[C@@H]1CCN1c1cc(F)c(F)cc1F)B(O)O |
| InChI | InChI=1S/C18H24BF3N2O4/c1-10(2)7-17(19(27)28)23-18(26)4-3-16(25)14-5-6-24(14)15-9-12(21)11(20)8-13(15)22/h8-10,14,17,27-28H,3-7H2,1-2H3,(H,23,26)/t14-,17+/m0/s1 |
| InChIKey | LLFOHFWVFSJPMO-WMLDXEAASA-N |
| XLogP | 1.57 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.21 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|