C15H27BN2O4 — CID 158601120
[(1R)-1-[[4-[(2S)-1-cyclopropylazetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid (PubChem CID 158601120) has the molecular formula C15H27BN2O4 and a molecular weight of 310.20 g/mol. Its IUPAC name is [(1R)-1-[[4-[(2S)-1-cyclopropylazetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid.
| Compound Name | [(1R)-1-[[4-[(2S)-1-cyclopropylazetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
|---|---|
| PubChem CID | 158601120 |
| Molecular Formula | C15H27BN2O4 |
| Molecular Weight | 310.20 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | [(1R)-1-[[4-[(2S)-1-cyclopropylazetidin-2-yl]-4-oxobutanoyl]amino]-3-methylbutyl]boronic acid |
| SMILES | CC(C)C[C@H](NC(=O)CCC(=O)[C@@H]1CCN1C1CC1)B(O)O |
| InChI | InChI=1S/C15H27BN2O4/c1-10(2)9-14(16(21)22)17-15(20)6-5-13(19)12-7-8-18(12)11-3-4-11/h10-12,14,21-22H,3-9H2,1-2H3,(H,17,20)/t12-,14-/m0/s1 |
| InChIKey | VLTAPWYVJGAZEE-JSGCOSHPSA-N |
| XLogP | 0.12 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.20 |
| LogP ≤ 5 | 0.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|