About 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane
5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane (PubChem CID 159187156) has the molecular formula C10H11FN2O3S
and a molecular weight of 257.28 g/mol. Its IUPAC name is 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane.
Molecular Properties
| Compound Name | 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane |
| PubChem CID | 159187156 |
| Molecular Formula | C10H11FN2O3S |
| Molecular Weight | 257.28 g/mol |
| Exact Mass | 257.05 |
| IUPAC Name | 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane |
| SMILES | CS(C)(=O)=O.[18F]c1onnc1-c1ccccc1 |
| InChI | InChI=1S/C8H5FN2O.C2H6O2S/c9-8-7(10-11-12-8)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;1-2H3/i9-1; |
| InChIKey | KNPZWNMUJWBRNA-UFZKRULUSA-N |
| XLogP | 1.54 |
| TPSA | 73.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.28 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane?
The IUPAC name of 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane (CID 159187156) is 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane.
What is the SMILES notation for 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane?
The canonical SMILES for 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane is CS(C)(=O)=O.[18F]c1onnc1-c1ccccc1.
What is the InChIKey of 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane?
The InChIKey is KNPZWNMUJWBRNA-UFZKRULUSA-N. The full InChI is InChI=1S/C8H5FN2O.C2H6O2S/c9-8-7(10-11-12-8)6-4-2-1-3-5-6;1-5(2,3)4/h1-5H;1-2H3/i9-1;.
What are the key properties of 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane?
5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane has a molecular weight of 257.28 g/mol, XLogP of 1.54, 1 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(18F)fluoro-4-phenyloxadiazole;methylsulfonylmethane is sourced from PubChem (CID 159187156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).