About bromic acid;3-(bromomethyl)-5-methylpyridine
bromic acid;3-(bromomethyl)-5-methylpyridine (PubChem CID 159195329) has the molecular formula C7H9Br2NO3
and a molecular weight of 314.96 g/mol. Its IUPAC name is bromic acid;3-(bromomethyl)-5-methylpyridine.
Molecular Properties
| Compound Name | bromic acid;3-(bromomethyl)-5-methylpyridine |
| PubChem CID | 159195329 |
| Molecular Formula | C7H9Br2NO3 |
| Molecular Weight | 314.96 g/mol |
| Exact Mass | 312.89 |
| IUPAC Name | bromic acid;3-(bromomethyl)-5-methylpyridine |
| SMILES | Cc1cncc(CBr)c1.[O-][Br+2]([O-])O |
| InChI | InChI=1S/C7H8BrN.BrHO3/c1-6-2-7(3-8)5-9-4-6;2-1(3)4/h2,4-5H,3H2,1H3;2H |
| InChIKey | KOOXOSDJIHOSIQ-UHFFFAOYSA-N |
| XLogP | -0.65 |
| TPSA | 79.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.96 |
| LogP ≤ 5 | -0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze bromic acid;3-(bromomethyl)-5-methylpyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bromic acid;3-(bromomethyl)-5-methylpyridine?
The IUPAC name of bromic acid;3-(bromomethyl)-5-methylpyridine (CID 159195329) is bromic acid;3-(bromomethyl)-5-methylpyridine.
What is the SMILES notation for bromic acid;3-(bromomethyl)-5-methylpyridine?
The canonical SMILES for bromic acid;3-(bromomethyl)-5-methylpyridine is Cc1cncc(CBr)c1.[O-][Br+2]([O-])O.
What is the InChIKey of bromic acid;3-(bromomethyl)-5-methylpyridine?
The InChIKey is KOOXOSDJIHOSIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8BrN.BrHO3/c1-6-2-7(3-8)5-9-4-6;2-1(3)4/h2,4-5H,3H2,1H3;2H.
What are the key properties of bromic acid;3-(bromomethyl)-5-methylpyridine?
bromic acid;3-(bromomethyl)-5-methylpyridine has a molecular weight of 314.96 g/mol, XLogP of -0.65, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bromic acid;3-(bromomethyl)-5-methylpyridine is sourced from PubChem (CID 159195329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).