C24H42N2O5 — CID 159205466
(1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-morpholin-4-ylheptan-2-ol (PubChem CID 159205466) has the molecular formula C24H42N2O5 and a molecular weight of 438.61 g/mol. Its IUPAC name is (1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-morpholin-4-ylheptan-2-ol.
| Compound Name | (1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-morpholin-4-ylheptan-2-ol |
|---|---|
| PubChem CID | 159205466 |
| Molecular Formula | C24H42N2O5 |
| Molecular Weight | 438.61 g/mol |
| Exact Mass | 438.31 |
| IUPAC Name | (1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-morpholin-4-ylheptan-2-ol |
| SMILES | COCCCOc1cc(C[C@H](CC[C@H](O)[C@@H](N)N2CCOCC2)C(C)C)ccc1OC |
| InChI | InChI=1S/C24H42N2O5/c1-18(2)20(7-8-21(27)24(25)26-10-14-30-15-11-26)16-19-6-9-22(29-4)23(17-19)31-13-5-12-28-3/h6,9,17-18,20-21,24,27H,5,7-8,10-16,25H2,1-4H3/t20-,21-,24-/m0/s1 |
| InChIKey | KPVARWTUWQJEIS-HFMPRLQTSA-N |
| XLogP | 2.68 |
| TPSA | 86.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.61 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|