C26H48N2O4 — CID 160695275
(1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-(3-methylpentan-3-ylamino)heptan-2-ol (PubChem CID 160695275) has the molecular formula C26H48N2O4 and a molecular weight of 452.68 g/mol. Its IUPAC name is (1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-(3-methylpentan-3-ylamino)heptan-2-ol.
| Compound Name | (1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-(3-methylpentan-3-ylamino)heptan-2-ol |
|---|---|
| PubChem CID | 160695275 |
| Molecular Formula | C26H48N2O4 |
| Molecular Weight | 452.68 g/mol |
| Exact Mass | 452.36 |
| IUPAC Name | (1S,2S,5S)-1-amino-5-[[4-methoxy-3-(3-methoxypropoxy)phenyl]methyl]-6-methyl-1-(3-methylpentan-3-ylamino)heptan-2-ol |
| SMILES | CCC(C)(CC)N[C@H](N)[C@@H](O)CC[C@@H](Cc1ccc(OC)c(OCCCOC)c1)C(C)C |
| InChI | InChI=1S/C26H48N2O4/c1-8-26(5,9-2)28-25(27)22(29)13-12-21(19(3)4)17-20-11-14-23(31-7)24(18-20)32-16-10-15-30-6/h11,14,18-19,21-22,25,28-29H,8-10,12-13,15-17,27H2,1-7H3/t21-,22-,25-/m0/s1 |
| InChIKey | RPXLEAQHXJGGAH-HWBMXIPRSA-N |
| XLogP | 4.52 |
| TPSA | 85.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.68 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|