About 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine
1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine (PubChem CID 159205777) has the molecular formula C9H16N8
and a molecular weight of 236.28 g/mol. Its IUPAC name is 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine.
Molecular Properties
| Compound Name | 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine |
| PubChem CID | 159205777 |
| Molecular Formula | C9H16N8 |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine |
| SMILES | Cn1cc(N)cn1.Cn1cc(N=C(N)N)cn1 |
| InChI | InChI=1S/C5H9N5.C4H7N3/c1-10-3-4(2-8-10)9-5(6)7;1-7-3-4(5)2-6-7/h2-3H,1H3,(H4,6,7,9);2-3H,5H2,1H3 |
| InChIKey | KPWBYMOUJAZSIM-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 126.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine?
The IUPAC name of 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine (CID 159205777) is 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine.
What is the SMILES notation for 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine?
The canonical SMILES for 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine is Cn1cc(N)cn1.Cn1cc(N=C(N)N)cn1.
What is the InChIKey of 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine?
The InChIKey is KPWBYMOUJAZSIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9N5.C4H7N3/c1-10-3-4(2-8-10)9-5(6)7;1-7-3-4(5)2-6-7/h2-3H,1H3,(H4,6,7,9);2-3H,5H2,1H3.
What are the key properties of 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine?
1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine has a molecular weight of 236.28 g/mol, XLogP of -0.67, 1 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methylpyrazol-4-amine;2-(1-methylpyrazol-4-yl)guanidine is sourced from PubChem (CID 159205777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).