C22H31FN5O4+ — CID 159209853
[(4-acetylpiperazin-1-yl)-(3-ethoxycarbonyl-6-fluoro-4-oxo-1,8-naphthyridin-1-yl)methyl]-ethyl-dimethylazanium (PubChem CID 159209853) has the molecular formula C22H31FN5O4+ and a molecular weight of 448.52 g/mol. Its IUPAC name is [(4-acetylpiperazin-1-yl)-(3-ethoxycarbonyl-6-fluoro-4-oxo-1,8-naphthyridin-1-yl)methyl]-ethyl-dimethylazanium.
| Compound Name | [(4-acetylpiperazin-1-yl)-(3-ethoxycarbonyl-6-fluoro-4-oxo-1,8-naphthyridin-1-yl)methyl]-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 159209853 |
| Molecular Formula | C22H31FN5O4+ |
| Molecular Weight | 448.52 g/mol |
| Exact Mass | 448.24 |
| IUPAC Name | [(4-acetylpiperazin-1-yl)-(3-ethoxycarbonyl-6-fluoro-4-oxo-1,8-naphthyridin-1-yl)methyl]-ethyl-dimethylazanium |
| SMILES | CCOC(=O)c1cn(C(N2CCN(C(C)=O)CC2)[N+](C)(C)CC)c2ncc(F)cc2c1=O |
| InChI | InChI=1S/C22H31FN5O4/c1-6-28(4,5)22(26-10-8-25(9-11-26)15(3)29)27-14-18(21(31)32-7-2)19(30)17-12-16(23)13-24-20(17)27/h12-14,22H,6-11H2,1-5H3/q+1 |
| InChIKey | KQIXSQXMRHQEAF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 84.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.52 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|