C15H26Cl2N4O2S — CID 159216256
2-[4-(2-imino-5-methyl-3-propylimidazolidin-1-yl)sulfonylphenyl]ethanamine;dihydrochloride (PubChem CID 159216256) has the molecular formula C15H26Cl2N4O2S and a molecular weight of 397.37 g/mol. Its IUPAC name is 2-[4-(2-imino-5-methyl-3-propylimidazolidin-1-yl)sulfonylphenyl]ethanamine;dihydrochloride.
| Compound Name | 2-[4-(2-imino-5-methyl-3-propylimidazolidin-1-yl)sulfonylphenyl]ethanamine;dihydrochloride |
|---|---|
| PubChem CID | 159216256 |
| Molecular Formula | C15H26Cl2N4O2S |
| Molecular Weight | 397.37 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | 2-[4-(2-imino-5-methyl-3-propylimidazolidin-1-yl)sulfonylphenyl]ethanamine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C1\N(CCC)CC(C)N1S(=O)(=O)c1ccc(CCN)cc1 |
| InChI | InChI=1S/C15H24N4O2S.2ClH/c1-3-10-18-11-12(2)19(15(18)17)22(20,21)14-6-4-13(5-7-14)8-9-16;;/h4-7,12,17H,3,8-11,16H2,1-2H3;2*1H/b17-15+;; |
| InChIKey | KRCLYFSUYKGUDP-UVVJDXDRSA-N |
| XLogP | 2.07 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.37 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|