C15H24N4O2S — CID 154087086
4-(3-butyl-5-ethyl-2-iminoimidazolidin-1-yl)sulfonylaniline (PubChem CID 154087086) has the molecular formula C15H24N4O2S and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-(3-butyl-5-ethyl-2-iminoimidazolidin-1-yl)sulfonylaniline.
| Compound Name | 4-(3-butyl-5-ethyl-2-iminoimidazolidin-1-yl)sulfonylaniline |
|---|---|
| PubChem CID | 154087086 |
| Molecular Formula | C15H24N4O2S |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 4-(3-butyl-5-ethyl-2-iminoimidazolidin-1-yl)sulfonylaniline |
| SMILES | [H]/N=C1\N(CCCC)CC(CC)N1S(=O)(=O)c1ccc(N)cc1 |
| InChI | InChI=1S/C15H24N4O2S/c1-3-5-10-18-11-13(4-2)19(15(18)17)22(20,21)14-8-6-12(16)7-9-14/h6-9,13,17H,3-5,10-11,16H2,1-2H3/b17-15+ |
| InChIKey | OSONKFCDDMNGKI-BMRADRMJSA-N |
| XLogP | 2.09 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|