C17H26N4O3S — CID 154085320
N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]acetamide (PubChem CID 154085320) has the molecular formula C17H26N4O3S and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]acetamide.
| Compound Name | N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]acetamide |
|---|---|
| PubChem CID | 154085320 |
| Molecular Formula | C17H26N4O3S |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.17 |
| IUPAC Name | N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]acetamide |
| SMILES | [H]/N=C1\N(CCCC)CCN1S(=O)(=O)c1ccc(CCNC(C)=O)cc1 |
| InChI | InChI=1S/C17H26N4O3S/c1-3-4-11-20-12-13-21(17(20)18)25(23,24)16-7-5-15(6-8-16)9-10-19-14(2)22/h5-8,18H,3-4,9-13H2,1-2H3,(H,19,22)/b18-17+ |
| InChIKey | DEWFPFYAXBRYJB-ISLYRVAYSA-N |
| XLogP | 1.41 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|