C16H28Cl2N4O2S — CID 161393861
3-[4-(3-tert-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propan-1-amine;dihydrochloride (PubChem CID 161393861) has the molecular formula C16H28Cl2N4O2S and a molecular weight of 411.40 g/mol. Its IUPAC name is 3-[4-(3-tert-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propan-1-amine;dihydrochloride.
| Compound Name | 3-[4-(3-tert-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propan-1-amine;dihydrochloride |
|---|---|
| PubChem CID | 161393861 |
| Molecular Formula | C16H28Cl2N4O2S |
| Molecular Weight | 411.40 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 3-[4-(3-tert-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propan-1-amine;dihydrochloride |
| SMILES | Cl.Cl.[H]/N=C1\N(C(C)(C)C)CCN1S(=O)(=O)c1ccc(CCCN)cc1 |
| InChI | InChI=1S/C16H26N4O2S.2ClH/c1-16(2,3)19-11-12-20(15(19)18)23(21,22)14-8-6-13(7-9-14)5-4-10-17;;/h6-9,18H,4-5,10-12,17H2,1-3H3;2*1H/b18-15+;; |
| InChIKey | VTIKOCGOTHSWCC-VZRGYXGKSA-N |
| XLogP | 2.46 |
| TPSA | 90.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.40 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|