C21H33ClN4O2S — CID 20836383
(E)-N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]but-2-en-1-amine;hydrochloride (PubChem CID 20836383) has the molecular formula C21H33ClN4O2S and a molecular weight of 441.04 g/mol. Its IUPAC name is (E)-N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]but-2-en-1-amine;hydrochloride.
| Compound Name | (E)-N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]but-2-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 20836383 |
| Molecular Formula | C21H33ClN4O2S |
| Molecular Weight | 441.04 g/mol |
| Exact Mass | 440.20 |
| IUPAC Name | (E)-N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]but-2-en-1-amine;hydrochloride |
| SMILES | Cl.[H]/N=C1\N(C2CCCCC2)CCN1S(=O)(=O)c1ccc(CCNC/C=C/C)cc1 |
| InChI | InChI=1S/C21H32N4O2S.ClH/c1-2-3-14-23-15-13-18-9-11-20(12-10-18)28(26,27)25-17-16-24(21(25)22)19-7-5-4-6-8-19;/h2-3,9-12,19,22-23H,4-8,13-17H2,1H3;1H/b3-2+,22-21+; |
| InChIKey | USKFCRBEGNBGAA-AYIKFJLPSA-N |
| XLogP | 3.39 |
| TPSA | 76.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.04 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|