C25H32N4O4S — CID 13155039
N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-4-methoxybenzamide (PubChem CID 13155039) has the molecular formula C25H32N4O4S and a molecular weight of 484.62 g/mol. Its IUPAC name is N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-4-methoxybenzamide.
| Compound Name | N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-4-methoxybenzamide |
|---|---|
| PubChem CID | 13155039 |
| Molecular Formula | C25H32N4O4S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | N-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-4-methoxybenzamide |
| SMILES | [H]/N=C1\N(C2CCCCC2)CCN1S(=O)(=O)c1ccc(CCNC(=O)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/C25H32N4O4S/c1-33-22-11-9-20(10-12-22)24(30)27-16-15-19-7-13-23(14-8-19)34(31,32)29-18-17-28(25(29)26)21-5-3-2-4-6-21/h7-14,21,26H,2-6,15-18H2,1H3,(H,27,30)/b26-25+ |
| InChIKey | VFQFRQPAWYMJNG-OCEACIFDSA-N |
| XLogP | 3.24 |
| TPSA | 102.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|