C27H36N4O5S — CID 163919906
N-[2-[4-[2-imino-3-(2-methylcyclohexyl)imidazolidin-1-yl]sulfonylphenyl]ethyl]-3,4-dimethoxybenzamide (PubChem CID 163919906) has the molecular formula C27H36N4O5S and a molecular weight of 528.68 g/mol. Its IUPAC name is N-[2-[4-[2-imino-3-(2-methylcyclohexyl)imidazolidin-1-yl]sulfonylphenyl]ethyl]-3,4-dimethoxybenzamide.
| Compound Name | N-[2-[4-[2-imino-3-(2-methylcyclohexyl)imidazolidin-1-yl]sulfonylphenyl]ethyl]-3,4-dimethoxybenzamide |
|---|---|
| PubChem CID | 163919906 |
| Molecular Formula | C27H36N4O5S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.24 |
| IUPAC Name | N-[2-[4-[2-imino-3-(2-methylcyclohexyl)imidazolidin-1-yl]sulfonylphenyl]ethyl]-3,4-dimethoxybenzamide |
| SMILES | [H]/N=C1/N(C2CCCCC2C)CCN1S(=O)(=O)c1ccc(CCNC(=O)c2ccc(OC)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H36N4O5S/c1-19-6-4-5-7-23(19)30-16-17-31(27(30)28)37(33,34)22-11-8-20(9-12-22)14-15-29-26(32)21-10-13-24(35-2)25(18-21)36-3/h8-13,18-19,23,28H,4-7,14-17H2,1-3H3,(H,29,32)/b28-27- |
| InChIKey | QZNOUZQFGHAFPL-DQSJHHFOSA-N |
| XLogP | 3.50 |
| TPSA | 112.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|