C22H35N5O2S2 — CID 13147604
1-butyl-3-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]thiourea (PubChem CID 13147604) has the molecular formula C22H35N5O2S2 and a molecular weight of 465.69 g/mol. Its IUPAC name is 1-butyl-3-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]thiourea.
| Compound Name | 1-butyl-3-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]thiourea |
|---|---|
| PubChem CID | 13147604 |
| Molecular Formula | C22H35N5O2S2 |
| Molecular Weight | 465.69 g/mol |
| Exact Mass | 465.22 |
| IUPAC Name | 1-butyl-3-[2-[4-(3-cyclohexyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]thiourea |
| SMILES | [H]/N=C1\N(C2CCCCC2)CCN1S(=O)(=O)c1ccc(CCNC(=S)NCCCC)cc1 |
| InChI | InChI=1S/C22H35N5O2S2/c1-2-3-14-24-22(30)25-15-13-18-9-11-20(12-10-18)31(28,29)27-17-16-26(21(27)23)19-7-5-4-6-8-19/h9-12,19,23H,2-8,13-17H2,1H3,(H2,24,25,30)/b23-21+ |
| InChIKey | QGGSLCBVTTYVKD-XTQSDGFTSA-N |
| XLogP | 3.07 |
| TPSA | 88.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.69 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|