C20H32N4O3S — CID 154093984
N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]pentanamide (PubChem CID 154093984) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]pentanamide.
| Compound Name | N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]pentanamide |
|---|---|
| PubChem CID | 154093984 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[2-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]pentanamide |
| SMILES | [H]/N=C1\N(CCCC)CCN1S(=O)(=O)c1ccc(CCNC(=O)CCCC)cc1 |
| InChI | InChI=1S/C20H32N4O3S/c1-3-5-7-19(25)22-13-12-17-8-10-18(11-9-17)28(26,27)24-16-15-23(20(24)21)14-6-4-2/h8-11,21H,3-7,12-16H2,1-2H3,(H,22,25)/b21-20+ |
| InChIKey | CUVQBJMWRGMHCY-QZQOTICOSA-N |
| XLogP | 2.58 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|