C18H28N4O3S — CID 154112809
N-[3-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propyl]acetamide (PubChem CID 154112809) has the molecular formula C18H28N4O3S and a molecular weight of 380.51 g/mol. Its IUPAC name is N-[3-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propyl]acetamide.
| Compound Name | N-[3-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propyl]acetamide |
|---|---|
| PubChem CID | 154112809 |
| Molecular Formula | C18H28N4O3S |
| Molecular Weight | 380.51 g/mol |
| Exact Mass | 380.19 |
| IUPAC Name | N-[3-[4-(3-butyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]propyl]acetamide |
| SMILES | [H]/N=C1\N(CCCC)CCN1S(=O)(=O)c1ccc(CCCNC(C)=O)cc1 |
| InChI | InChI=1S/C18H28N4O3S/c1-3-4-12-21-13-14-22(18(21)19)26(24,25)17-9-7-16(8-10-17)6-5-11-20-15(2)23/h7-10,19H,3-6,11-14H2,1-2H3,(H,20,23)/b19-18+ |
| InChIKey | ZKXXCMAQAGYFFO-VHEBQXMUSA-N |
| XLogP | 1.80 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.51 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|