C24H36N4O3S — CID 159621088
N-[2-[4-(3-cyclopentyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-1-methylcyclohexane-1-carboxamide (PubChem CID 159621088) has the molecular formula C24H36N4O3S and a molecular weight of 460.64 g/mol. Its IUPAC name is N-[2-[4-(3-cyclopentyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-1-methylcyclohexane-1-carboxamide.
| Compound Name | N-[2-[4-(3-cyclopentyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-1-methylcyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 159621088 |
| Molecular Formula | C24H36N4O3S |
| Molecular Weight | 460.64 g/mol |
| Exact Mass | 460.25 |
| IUPAC Name | N-[2-[4-(3-cyclopentyl-2-iminoimidazolidin-1-yl)sulfonylphenyl]ethyl]-1-methylcyclohexane-1-carboxamide |
| SMILES | [H]/N=C1\N(C2CCCC2)CCN1S(=O)(=O)c1ccc(CCNC(=O)C2(C)CCCCC2)cc1 |
| InChI | InChI=1S/C24H36N4O3S/c1-24(14-5-2-6-15-24)22(29)26-16-13-19-9-11-21(12-10-19)32(30,31)28-18-17-27(23(28)25)20-7-3-4-8-20/h9-12,20,25H,2-8,13-18H2,1H3,(H,26,29)/b25-23+ |
| InChIKey | MNWYOZIAIRQJSX-WJTDDFOZSA-N |
| XLogP | 3.50 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.64 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|