C27H20N6O3 — CID 159224958
1-(4-isocyanophenyl)-3-[7-(4-isocyanophenyl)-5-(4-methylphenyl)-6-oxo-2-oxa-5,7-diazaspiro[3.4]octan-8-ylidene]urea (PubChem CID 159224958) has the molecular formula C27H20N6O3 and a molecular weight of 476.50 g/mol. Its IUPAC name is 1-(4-isocyanophenyl)-3-[7-(4-isocyanophenyl)-5-(4-methylphenyl)-6-oxo-2-oxa-5,7-diazaspiro[3.4]octan-8-ylidene]urea.
| Compound Name | 1-(4-isocyanophenyl)-3-[7-(4-isocyanophenyl)-5-(4-methylphenyl)-6-oxo-2-oxa-5,7-diazaspiro[3.4]octan-8-ylidene]urea |
|---|---|
| PubChem CID | 159224958 |
| Molecular Formula | C27H20N6O3 |
| Molecular Weight | 476.50 g/mol |
| Exact Mass | 476.16 |
| IUPAC Name | 1-(4-isocyanophenyl)-3-[7-(4-isocyanophenyl)-5-(4-methylphenyl)-6-oxo-2-oxa-5,7-diazaspiro[3.4]octan-8-ylidene]urea |
| SMILES | [C-]#[N+]c1ccc(NC(=O)N=C2N(c3ccc([N+]#[C-])cc3)C(=O)N(c3ccc(C)cc3)C23COC3)cc1 |
| InChI | InChI=1S/C27H20N6O3/c1-18-4-12-23(13-5-18)33-26(35)32(22-14-10-20(29-3)11-15-22)24(27(33)16-36-17-27)31-25(34)30-21-8-6-19(28-2)7-9-21/h4-15H,16-17H2,1H3,(H,30,34) |
| InChIKey | FRYZSAZDRWGDTA-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 82.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|