C19H15F3N2O3 — CID 161228217
7-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]-2-oxa-5,7-diazaspiro[3.4]octane-6,8-dione (PubChem CID 161228217) has the molecular formula C19H15F3N2O3 and a molecular weight of 376.33 g/mol. Its IUPAC name is 7-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]-2-oxa-5,7-diazaspiro[3.4]octane-6,8-dione.
| Compound Name | 7-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]-2-oxa-5,7-diazaspiro[3.4]octane-6,8-dione |
|---|---|
| PubChem CID | 161228217 |
| Molecular Formula | C19H15F3N2O3 |
| Molecular Weight | 376.33 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 7-(4-methylphenyl)-5-[4-(trifluoromethyl)phenyl]-2-oxa-5,7-diazaspiro[3.4]octane-6,8-dione |
| SMILES | Cc1ccc(N2C(=O)N(c3ccc(C(F)(F)F)cc3)C3(COC3)C2=O)cc1 |
| InChI | InChI=1S/C19H15F3N2O3/c1-12-2-6-14(7-3-12)23-16(25)18(10-27-11-18)24(17(23)26)15-8-4-13(5-9-15)19(20,21)22/h2-9H,10-11H2,1H3 |
| InChIKey | YNJATJIGTGELRG-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.33 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|