C20H21ClN2O2 — CID 145417028
3-(4-chlorophenyl)-5,5-diethyl-1-(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 145417028) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-5,5-diethyl-1-(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-(4-chlorophenyl)-5,5-diethyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 145417028 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | 3-(4-chlorophenyl)-5,5-diethyl-1-(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | CCC1(CC)C(=O)N(c2ccc(Cl)cc2)C(=O)N1c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21ClN2O2/c1-4-20(5-2)18(24)22(16-12-8-15(21)9-13-16)19(25)23(20)17-10-6-14(3)7-11-17/h6-13H,4-5H2,1-3H3 |
| InChIKey | HTWUKXYESJFJDO-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|