C13H11F3N2O3 — CID 25174724
1-(4-methylphenyl)-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 25174724) has the molecular formula C13H11F3N2O3 and a molecular weight of 300.24 g/mol. Its IUPAC name is 1-(4-methylphenyl)-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 1-(4-methylphenyl)-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 25174724 |
| Molecular Formula | C13H11F3N2O3 |
| Molecular Weight | 300.24 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1-(4-methylphenyl)-3-(2,2,2-trifluoroethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | Cc1ccc(N2C(=O)CC(=O)N(CC(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C13H11F3N2O3/c1-8-2-4-9(5-3-8)18-11(20)6-10(19)17(12(18)21)7-13(14,15)16/h2-5H,6-7H2,1H3 |
| InChIKey | NXFSMUBOROONIU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|