C24H46N2O — CID 159227572
1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;1-(oxetan-3-yl)-4-propan-2-ylpiperidine (PubChem CID 159227572) has the molecular formula C24H46N2O and a molecular weight of 378.65 g/mol. Its IUPAC name is 1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;1-(oxetan-3-yl)-4-propan-2-ylpiperidine.
| Compound Name | 1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;1-(oxetan-3-yl)-4-propan-2-ylpiperidine |
|---|---|
| PubChem CID | 159227572 |
| Molecular Formula | C24H46N2O |
| Molecular Weight | 378.65 g/mol |
| Exact Mass | 378.36 |
| IUPAC Name | 1-(cyclobutylmethyl)-4-propan-2-ylpiperidine;1-(oxetan-3-yl)-4-propan-2-ylpiperidine |
| SMILES | CC(C)C1CCN(C2COC2)CC1.CC(C)C1CCN(CC2CCC2)CC1 |
| InChI | InChI=1S/C13H25N.C11H21NO/c1-11(2)13-6-8-14(9-7-13)10-12-4-3-5-12;1-9(2)10-3-5-12(6-4-10)11-7-13-8-11/h11-13H,3-10H2,1-2H3;9-11H,3-8H2,1-2H3 |
| InChIKey | KSMHJYNMTWNLNT-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.65 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |