C24H20N3+ — CID 159233577
7-(5H-imidazo[2,1-a]isoindol-4-ium-1-yl)-6,8-dimethyl-5H-indeno[1,2-c]pyridine (PubChem CID 159233577) has the molecular formula C24H20N3+ and a molecular weight of 350.44 g/mol. Its IUPAC name is 7-(5H-imidazo[2,1-a]isoindol-4-ium-1-yl)-6,8-dimethyl-5H-indeno[1,2-c]pyridine.
| Compound Name | 7-(5H-imidazo[2,1-a]isoindol-4-ium-1-yl)-6,8-dimethyl-5H-indeno[1,2-c]pyridine |
|---|---|
| PubChem CID | 159233577 |
| Molecular Formula | C24H20N3+ |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 7-(5H-imidazo[2,1-a]isoindol-4-ium-1-yl)-6,8-dimethyl-5H-indeno[1,2-c]pyridine |
| SMILES | Cc1cc2c(c(C)c1-n1cc[n+]3c1-c1ccccc1C3)Cc1ccncc1-2 |
| InChI | InChI=1S/C24H20N3/c1-15-11-21-20(12-17-7-8-25-13-22(17)21)16(2)23(15)27-10-9-26-14-18-5-3-4-6-19(18)24(26)27/h3-11,13H,12,14H2,1-2H3/q+1 |
| InChIKey | BPPAPLODRFQYRO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|