C13H26N2O3S — CID 159233646
N-tert-butylethenesulfonamide;N-tert-butylprop-2-enamide (PubChem CID 159233646) has the molecular formula C13H26N2O3S and a molecular weight of 290.43 g/mol. Its IUPAC name is N-tert-butylethenesulfonamide;N-tert-butylprop-2-enamide.
| Compound Name | N-tert-butylethenesulfonamide;N-tert-butylprop-2-enamide |
|---|---|
| PubChem CID | 159233646 |
| Molecular Formula | C13H26N2O3S |
| Molecular Weight | 290.43 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | N-tert-butylethenesulfonamide;N-tert-butylprop-2-enamide |
| SMILES | C=CC(=O)NC(C)(C)C.C=CS(=O)(=O)NC(C)(C)C |
| InChI | InChI=1S/C7H13NO.C6H13NO2S/c1-5-6(9)8-7(2,3)4;1-5-10(8,9)7-6(2,3)4/h5H,1H2,2-4H3,(H,8,9);5,7H,1H2,2-4H3 |
| InChIKey | KTFAQAUQOXOKJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.43 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|